C27H17Cl3F3NO3 — CID 123494001
2-[1-[4-[2-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)-3H-furan-4-yl]phenyl]ethyl]isoindole-1,3-dione (PubChem CID 123494001) has the molecular formula C27H17Cl3F3NO3 and a molecular weight of 566.79 g/mol. Its IUPAC name is 2-[1-[4-[2-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)-3H-furan-4-yl]phenyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-[2-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)-3H-furan-4-yl]phenyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 123494001 |
| Molecular Formula | C27H17Cl3F3NO3 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 565.02 |
| IUPAC Name | 2-[1-[4-[2-(3,4,5-trichlorophenyl)-2-(trifluoromethyl)-3H-furan-4-yl]phenyl]ethyl]isoindole-1,3-dione |
| SMILES | CC(c1ccc(C2=COC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H17Cl3F3NO3/c1-14(34-24(35)19-4-2-3-5-20(19)25(34)36)15-6-8-16(9-7-15)17-12-26(37-13-17,27(31,32)33)18-10-21(28)23(30)22(29)11-18/h2-11,13-14H,12H2,1H3 |
| InChIKey | XBKIUHSLVCYLOY-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|