C24H38N6 — CID 123494543
2-N-butyl-5-[5-[(tert-butylamino)methyl]-2-pyridinyl]-4-N-cyclohexylpyrimidine-2,4-diamine (PubChem CID 123494543) has the molecular formula C24H38N6 and a molecular weight of 410.61 g/mol. Its IUPAC name is 2-N-butyl-5-[5-[(tert-butylamino)methyl]-2-pyridinyl]-4-N-cyclohexylpyrimidine-2,4-diamine.
| Compound Name | 2-N-butyl-5-[5-[(tert-butylamino)methyl]-2-pyridinyl]-4-N-cyclohexylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 123494543 |
| Molecular Formula | C24H38N6 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | 2-N-butyl-5-[5-[(tert-butylamino)methyl]-2-pyridinyl]-4-N-cyclohexylpyrimidine-2,4-diamine |
| SMILES | CCCCNc1ncc(-c2ccc(CNC(C)(C)C)cn2)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C24H38N6/c1-5-6-14-25-23-27-17-20(22(30-23)29-19-10-8-7-9-11-19)21-13-12-18(15-26-21)16-28-24(2,3)4/h12-13,15,17,19,28H,5-11,14,16H2,1-4H3,(H2,25,27,29,30) |
| InChIKey | UEYDHGDEFOJVSJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|