C24H28F3N7O2 — CID 123494570
6-[3-hydrazinyl-2-(hydroxymethyl)phenyl]-2-methyl-4-[[5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-2-pyridinyl]amino]pyridazin-3-one (PubChem CID 123494570) has the molecular formula C24H28F3N7O2 and a molecular weight of 503.53 g/mol. Its IUPAC name is 6-[3-hydrazinyl-2-(hydroxymethyl)phenyl]-2-methyl-4-[[5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-2-pyridinyl]amino]pyridazin-3-one.
| Compound Name | 6-[3-hydrazinyl-2-(hydroxymethyl)phenyl]-2-methyl-4-[[5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-2-pyridinyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 123494570 |
| Molecular Formula | C24H28F3N7O2 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 6-[3-hydrazinyl-2-(hydroxymethyl)phenyl]-2-methyl-4-[[5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-2-pyridinyl]amino]pyridazin-3-one |
| SMILES | Cn1nc(-c2cccc(NN)c2CO)cc(Nc2ccc(C3CCN(CC(F)(F)F)CC3)cn2)c1=O |
| InChI | InChI=1S/C24H28F3N7O2/c1-33-23(36)21(11-20(32-33)17-3-2-4-19(31-28)18(17)13-35)30-22-6-5-16(12-29-22)15-7-9-34(10-8-15)14-24(25,26)27/h2-6,11-12,15,31,35H,7-10,13-14,28H2,1H3,(H,29,30) |
| InChIKey | RHFOGFWAWHLUAO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 121.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|