C8H21N3Si3 — CID 123494624
4,4-bis(ethenyl)-1,2,2,3-tetramethyl-1,3,5,2,4,6-triazatrisilinane (PubChem CID 123494624) has the molecular formula C8H21N3Si3 and a molecular weight of 243.53 g/mol. Its IUPAC name is 4,4-bis(ethenyl)-1,2,2,3-tetramethyl-1,3,5,2,4,6-triazatrisilinane.
| Compound Name | 4,4-bis(ethenyl)-1,2,2,3-tetramethyl-1,3,5,2,4,6-triazatrisilinane |
|---|---|
| PubChem CID | 123494624 |
| Molecular Formula | C8H21N3Si3 |
| Molecular Weight | 243.53 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 4,4-bis(ethenyl)-1,2,2,3-tetramethyl-1,3,5,2,4,6-triazatrisilinane |
| SMILES | C=C[Si]1(C=C)N[SiH2]N(C)[Si](C)(C)N1C |
| InChI | InChI=1S/C8H21N3Si3/c1-7-14(8-2)9-12-10(3)13(5,6)11(14)4/h7-9H,1-2,12H2,3-6H3 |
| InChIKey | UKAFQDPRKBAJES-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.53 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|