C17H16O5 — CID 123495127
dimethyl 7-methoxytetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-3,4-dicarboxylate (PubChem CID 123495127) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is dimethyl 7-methoxytetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-3,4-dicarboxylate.
| Compound Name | dimethyl 7-methoxytetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 123495127 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | dimethyl 7-methoxytetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-3,4-dicarboxylate |
| SMILES | COC(=O)C12C=CC3(OC)c4ccccc4C1C32C(=O)OC |
| InChI | InChI=1S/C17H16O5/c1-20-13(18)15-8-9-16(22-3)11-7-5-4-6-10(11)12(15)17(15,16)14(19)21-2/h4-9,12H,1-3H3 |
| InChIKey | JVGCQMUHUIGXOZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|