About 1-hexa-3,4-dien-2-yl-2-methylcyclopropane
1-hexa-3,4-dien-2-yl-2-methylcyclopropane (PubChem CID 123495353) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is 1-hexa-3,4-dien-2-yl-2-methylcyclopropane.
Molecular Properties
| Compound Name | 1-hexa-3,4-dien-2-yl-2-methylcyclopropane |
| PubChem CID | 123495353 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 1-hexa-3,4-dien-2-yl-2-methylcyclopropane |
| SMILES | CC=C=CC(C)C1CC1C |
| InChI | InChI=1S/C10H16/c1-4-5-6-8(2)10-7-9(10)3/h4,6,8-10H,7H2,1-3H3 |
| InChIKey | WBJOYXRKJRTGID-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-hexa-3,4-dien-2-yl-2-methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexa-3,4-dien-2-yl-2-methylcyclopropane?
The IUPAC name of 1-hexa-3,4-dien-2-yl-2-methylcyclopropane (CID 123495353) is 1-hexa-3,4-dien-2-yl-2-methylcyclopropane.
What is the SMILES notation for 1-hexa-3,4-dien-2-yl-2-methylcyclopropane?
The canonical SMILES for 1-hexa-3,4-dien-2-yl-2-methylcyclopropane is CC=C=CC(C)C1CC1C.
What is the InChIKey of 1-hexa-3,4-dien-2-yl-2-methylcyclopropane?
The InChIKey is WBJOYXRKJRTGID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16/c1-4-5-6-8(2)10-7-9(10)3/h4,6,8-10H,7H2,1-3H3.
What are the key properties of 1-hexa-3,4-dien-2-yl-2-methylcyclopropane?
1-hexa-3,4-dien-2-yl-2-methylcyclopropane has a molecular weight of 136.24 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexa-3,4-dien-2-yl-2-methylcyclopropane is sourced from PubChem (CID 123495353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).