C26H31N2+ — CID 123496316
1-(6,7-dihydronaphthalen-1-ylmethyl)-3-[1-(2,3,5,6-tetrahydronaphthalen-1-yl)ethyl]-4,5-dihydroimidazol-1-ium (PubChem CID 123496316) has the molecular formula C26H31N2+ and a molecular weight of 371.55 g/mol. Its IUPAC name is 1-(6,7-dihydronaphthalen-1-ylmethyl)-3-[1-(2,3,5,6-tetrahydronaphthalen-1-yl)ethyl]-4,5-dihydroimidazol-1-ium.
| Compound Name | 1-(6,7-dihydronaphthalen-1-ylmethyl)-3-[1-(2,3,5,6-tetrahydronaphthalen-1-yl)ethyl]-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 123496316 |
| Molecular Formula | C26H31N2+ |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 1-(6,7-dihydronaphthalen-1-ylmethyl)-3-[1-(2,3,5,6-tetrahydronaphthalen-1-yl)ethyl]-4,5-dihydroimidazol-1-ium |
| SMILES | CC(C1=C2C=CCCC2=CCC1)N1C=[N+](Cc2cccc3c2=CCCC=3)CC1 |
| InChI | InChI=1S/C26H31N2/c1-20(24-15-7-11-22-9-3-5-14-26(22)24)28-17-16-27(19-28)18-23-12-6-10-21-8-2-4-13-25(21)23/h5-6,8,10-14,19-20H,2-4,7,9,15-18H2,1H3/q+1 |
| InChIKey | HZJKLTOBNIWYFI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|