C28H25Cl2N4O2+ — CID 123497305
[4-[2,5-dichloro-4-(3-pyridin-1-ium-1-ylpropyl)phenoxy]-3-pyridinyl]-(3,4-dihydro-2H-quinoxalin-1-yl)methanone (PubChem CID 123497305) has the molecular formula C28H25Cl2N4O2+ and a molecular weight of 520.44 g/mol. Its IUPAC name is [4-[2,5-dichloro-4-(3-pyridin-1-ium-1-ylpropyl)phenoxy]-3-pyridinyl]-(3,4-dihydro-2H-quinoxalin-1-yl)methanone.
| Compound Name | [4-[2,5-dichloro-4-(3-pyridin-1-ium-1-ylpropyl)phenoxy]-3-pyridinyl]-(3,4-dihydro-2H-quinoxalin-1-yl)methanone |
|---|---|
| PubChem CID | 123497305 |
| Molecular Formula | C28H25Cl2N4O2+ |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | [4-[2,5-dichloro-4-(3-pyridin-1-ium-1-ylpropyl)phenoxy]-3-pyridinyl]-(3,4-dihydro-2H-quinoxalin-1-yl)methanone |
| SMILES | O=C(c1cnccc1Oc1cc(Cl)c(CCC[n+]2ccccc2)cc1Cl)N1CCNc2ccccc21 |
| InChI | InChI=1S/C28H25Cl2N4O2/c29-22-18-27(23(30)17-20(22)7-6-15-33-13-4-1-5-14-33)36-26-10-11-31-19-21(26)28(35)34-16-12-32-24-8-2-3-9-25(24)34/h1-5,8-11,13-14,17-19,32H,6-7,12,15-16H2/q+1 |
| InChIKey | RPHYLSGLRGIZOJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|