C8H15NO6S2 — CID 123497316
N-[2-(disulfanyloxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 123497316) has the molecular formula C8H15NO6S2 and a molecular weight of 285.34 g/mol. Its IUPAC name is N-[2-(disulfanyloxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[2-(disulfanyloxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 123497316 |
| Molecular Formula | C8H15NO6S2 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | N-[2-(disulfanyloxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(OSS)OC(CO)C(O)C1O |
| InChI | InChI=1S/C8H15NO6S2/c1-3(11)9-5-7(13)6(12)4(2-10)14-8(5)15-17-16/h4-8,10,12-13,16H,2H2,1H3,(H,9,11) |
| InChIKey | IHVLDVFNHWLCJK-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|