C26H19ClF3N4O3+ — CID 123497596
9-chloro-3-[(4-methoxyphenyl)methyl]-4-oxo-1-[3-(trifluoromethyl)phenyl]-2H-pyrimido[5,4-c][1,5]naphthyridin-1-ium-1-carbaldehyde (PubChem CID 123497596) has the molecular formula C26H19ClF3N4O3+ and a molecular weight of 527.91 g/mol. Its IUPAC name is 9-chloro-3-[(4-methoxyphenyl)methyl]-4-oxo-1-[3-(trifluoromethyl)phenyl]-2H-pyrimido[5,4-c][1,5]naphthyridin-1-ium-1-carbaldehyde.
| Compound Name | 9-chloro-3-[(4-methoxyphenyl)methyl]-4-oxo-1-[3-(trifluoromethyl)phenyl]-2H-pyrimido[5,4-c][1,5]naphthyridin-1-ium-1-carbaldehyde |
|---|---|
| PubChem CID | 123497596 |
| Molecular Formula | C26H19ClF3N4O3+ |
| Molecular Weight | 527.91 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 9-chloro-3-[(4-methoxyphenyl)methyl]-4-oxo-1-[3-(trifluoromethyl)phenyl]-2H-pyrimido[5,4-c][1,5]naphthyridin-1-ium-1-carbaldehyde |
| SMILES | COc1ccc(CN2C[N+](C=O)(c3cccc(C(F)(F)F)c3)c3c(cnc4ccc(Cl)nc34)C2=O)cc1 |
| InChI | InChI=1S/C26H19ClF3N4O3/c1-37-19-7-5-16(6-8-19)13-33-14-34(15-35,18-4-2-3-17(11-18)26(28,29)30)24-20(25(33)36)12-31-21-9-10-22(27)32-23(21)24/h2-12,15H,13-14H2,1H3/q+1 |
| InChIKey | MCNGXPUMHUTSPA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.91 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|