About 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide
3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide (PubChem CID 123497793) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide.
Molecular Properties
| Compound Name | 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide |
| PubChem CID | 123497793 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide |
| SMILES | CC=CC(=CC)CNC(=O)C(CN)(OC)OC |
| InChI | InChI=1S/C12H22N2O3/c1-5-7-10(6-2)8-14-11(15)12(9-13,16-3)17-4/h5-7H,8-9,13H2,1-4H3,(H,14,15) |
| InChIKey | NIVXNHDDPVRQKL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide?
The IUPAC name of 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide (CID 123497793) is 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide.
What is the SMILES notation for 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide?
The canonical SMILES for 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide is CC=CC(=CC)CNC(=O)C(CN)(OC)OC.
What is the InChIKey of 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide?
The InChIKey is NIVXNHDDPVRQKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3/c1-5-7-10(6-2)8-14-11(15)12(9-13,16-3)17-4/h5-7H,8-9,13H2,1-4H3,(H,14,15).
What are the key properties of 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide?
3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide has a molecular weight of 242.32 g/mol, XLogP of 0.57, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(2-ethylidenepent-3-enyl)-2,2-dimethoxypropanamide is sourced from PubChem (CID 123497793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).