C12H20O4 — CID 123498382
2,5,8,11-tetraoxabicyclo[10.4.0]hexadec-13-ene (PubChem CID 123498382) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2,5,8,11-tetraoxabicyclo[10.4.0]hexadec-13-ene.
| Compound Name | 2,5,8,11-tetraoxabicyclo[10.4.0]hexadec-13-ene |
|---|---|
| PubChem CID | 123498382 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2,5,8,11-tetraoxabicyclo[10.4.0]hexadec-13-ene |
| SMILES | C1=CC2OCCOCCOCCOC2CC1 |
| InChI | InChI=1S/C12H20O4/c1-2-4-12-11(3-1)15-9-7-13-5-6-14-8-10-16-12/h1,3,11-12H,2,4-10H2 |
| InChIKey | NPSQIWHWFPODDE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|