About bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate
bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate (PubChem CID 123498703) has the molecular formula C29H39BrO4S2
and a molecular weight of 595.67 g/mol. Its IUPAC name is bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate |
| PubChem CID | 123498703 |
| Molecular Formula | C29H39BrO4S2 |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate |
| SMILES | CCCCC(CC)COC(=O)c1cc2c(Br)c3sc(C(=O)OCC(CC)CCCC)cc3c(C)c2s1 |
| InChI | InChI=1S/C29H39BrO4S2/c1-6-10-12-19(8-3)16-33-28(31)23-14-21-18(5)26-22(25(30)27(21)36-23)15-24(35-26)29(32)34-17-20(9-4)13-11-7-2/h14-15,19-20H,6-13,16-17H2,1-5H3 |
| InChIKey | SXGOGKLSXKMVEJ-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate?
The IUPAC name of bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate (CID 123498703) is bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate.
What is the SMILES notation for bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate?
The canonical SMILES for bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate is CCCCC(CC)COC(=O)c1cc2c(Br)c3sc(C(=O)OCC(CC)CCCC)cc3c(C)c2s1.
What is the InChIKey of bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate?
The InChIKey is SXGOGKLSXKMVEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H39BrO4S2/c1-6-10-12-19(8-3)16-33-28(31)23-14-21-18(5)26-22(25(30)27(21)36-23)15-24(35-26)29(32)34-17-20(9-4)13-11-7-2/h14-15,19-20H,6-13,16-17H2,1-5H3.
What are the key properties of bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate?
bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate has a molecular weight of 595.67 g/mol, XLogP of 9.93, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethylhexyl) 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate is sourced from PubChem (CID 123498703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).