C12H14O3 — CID 123498759
[2-(2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanediol (PubChem CID 123498759) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is [2-(2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanediol.
| Compound Name | [2-(2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanediol |
|---|---|
| PubChem CID | 123498759 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | [2-(2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanediol |
| SMILES | OC(O)C1CC1c1cccc2c1CCO2 |
| InChI | InChI=1S/C12H14O3/c13-12(14)10-6-9(10)7-2-1-3-11-8(7)4-5-15-11/h1-3,9-10,12-14H,4-6H2 |
| InChIKey | AERGBUHSEXCNHV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|