C20H24FN3O4 — CID 123499787
17-(2-fluoroethyl)-4,10-dihydroxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione (PubChem CID 123499787) has the molecular formula C20H24FN3O4 and a molecular weight of 389.43 g/mol. Its IUPAC name is 17-(2-fluoroethyl)-4,10-dihydroxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione.
| Compound Name | 17-(2-fluoroethyl)-4,10-dihydroxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 123499787 |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 17-(2-fluoroethyl)-4,10-dihydroxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)C2(CCC3(O)C4Cc5ccc(O)cc5C3(CCN4CCF)C2)N1 |
| InChI | InChI=1S/C20H24FN3O4/c21-6-8-24-7-5-18-11-19(16(26)22-17(27)23-19)3-4-20(18,28)15(24)9-12-1-2-13(25)10-14(12)18/h1-2,10,15,25,28H,3-9,11H2,(H2,22,23,26,27) |
| InChIKey | HIIVVZDAAGNTKW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|