C18H21N7O2 — CID 123499898
1-[2-(dimethylamino)ethyl]-3-(7-methanimidoyl-3-oxo-2-phenyl-1H-pyrazolo[4,3-c]pyridin-6-yl)urea (PubChem CID 123499898) has the molecular formula C18H21N7O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-(7-methanimidoyl-3-oxo-2-phenyl-1H-pyrazolo[4,3-c]pyridin-6-yl)urea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-(7-methanimidoyl-3-oxo-2-phenyl-1H-pyrazolo[4,3-c]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 123499898 |
| Molecular Formula | C18H21N7O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-(7-methanimidoyl-3-oxo-2-phenyl-1H-pyrazolo[4,3-c]pyridin-6-yl)urea |
| SMILES | [H]/N=C/c1c(NC(=O)NCCN(C)C)ncc2c(=O)n(-c3ccccc3)[nH]c12 |
| InChI | InChI=1S/C18H21N7O2/c1-24(2)9-8-20-18(27)22-16-13(10-19)15-14(11-21-16)17(26)25(23-15)12-6-4-3-5-7-12/h3-7,10-11,19,23H,8-9H2,1-2H3,(H2,20,21,22,27)/b19-10+ |
| InChIKey | OFGVYQQKQZGMEZ-VXLYETTFSA-N |
| XLogP | 1.39 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|