About but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium
but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium (PubChem CID 123499958) has the molecular formula C14H30N+
and a molecular weight of 212.40 g/mol. Its IUPAC name is but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium.
Molecular Properties
| Compound Name | but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium |
| PubChem CID | 123499958 |
| Molecular Formula | C14H30N+ |
| Molecular Weight | 212.40 g/mol |
| Exact Mass | 212.24 |
| IUPAC Name | but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium |
| SMILES | CCC=C[N+](C)(C)CC(C)C(C)(C)CC |
| InChI | InChI=1S/C14H30N/c1-8-10-11-15(6,7)12-13(3)14(4,5)9-2/h10-11,13H,8-9,12H2,1-7H3/q+1 |
| InChIKey | KPQBJXFCHNHPRU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium?
The IUPAC name of but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium (CID 123499958) is but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium.
What is the SMILES notation for but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium?
The canonical SMILES for but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium is CCC=C[N+](C)(C)CC(C)C(C)(C)CC.
What is the InChIKey of but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium?
The InChIKey is KPQBJXFCHNHPRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N/c1-8-10-11-15(6,7)12-13(3)14(4,5)9-2/h10-11,13H,8-9,12H2,1-7H3/q+1.
What are the key properties of but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium?
but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium has a molecular weight of 212.40 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-enyl-dimethyl-(2,3,3-trimethylpentyl)azanium is sourced from PubChem (CID 123499958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).