C26H24N2O5S — CID 1235009
methyl 2-[(5R)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-(4-propan-2-ylphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 1235009) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is methyl 2-[(5R)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-(4-propan-2-ylphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(5R)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-(4-propan-2-ylphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 1235009 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | methyl 2-[(5R)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-(4-propan-2-ylphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccccc3)[C@H]2c2ccc(C(C)C)cc2)nc1C |
| InChI | InChI=1S/C26H24N2O5S/c1-14(2)16-10-12-17(13-11-16)20-19(21(29)18-8-6-5-7-9-18)22(30)24(31)28(20)26-27-15(3)23(34-26)25(32)33-4/h5-14,20,29H,1-4H3/t20-/m1/s1 |
| InChIKey | KUOQHTDSJFGQAB-HXUWFJFHSA-N |
| XLogP | 4.99 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|