C15H28 — CID 123501485
1-but-1-en-2-yl-2,3,4,5,6-pentamethylcyclohexane (PubChem CID 123501485) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 1-but-1-en-2-yl-2,3,4,5,6-pentamethylcyclohexane.
| Compound Name | 1-but-1-en-2-yl-2,3,4,5,6-pentamethylcyclohexane |
|---|---|
| PubChem CID | 123501485 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 1-but-1-en-2-yl-2,3,4,5,6-pentamethylcyclohexane |
| SMILES | C=C(CC)C1C(C)C(C)C(C)C(C)C1C |
| InChI | InChI=1S/C15H28/c1-8-9(2)15-13(6)11(4)10(3)12(5)14(15)7/h10-15H,2,8H2,1,3-7H3 |
| InChIKey | RLZJFMGFMYXKDV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|