C9H9N5O — CID 123501615
3-ethyl-8-isocyano-2-methylpyrazolo[1,5-a][1,3,5]triazin-4-one (PubChem CID 123501615) has the molecular formula C9H9N5O and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-ethyl-8-isocyano-2-methylpyrazolo[1,5-a][1,3,5]triazin-4-one.
| Compound Name | 3-ethyl-8-isocyano-2-methylpyrazolo[1,5-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 123501615 |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 3-ethyl-8-isocyano-2-methylpyrazolo[1,5-a][1,3,5]triazin-4-one |
| SMILES | [C-]#[N+]c1cnn2c(=O)n(CC)c(C)nc12 |
| InChI | InChI=1S/C9H9N5O/c1-4-13-6(2)12-8-7(10-3)5-11-14(8)9(13)15/h5H,4H2,1-2H3 |
| InChIKey | MTNHGXZEGQJTON-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 56.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|