About 4-(fluoroamino)-2,6-dimethylheptan-3-one
4-(fluoroamino)-2,6-dimethylheptan-3-one (PubChem CID 123501856) has the molecular formula C9H18FNO
and a molecular weight of 175.25 g/mol. Its IUPAC name is 4-(fluoroamino)-2,6-dimethylheptan-3-one.
Molecular Properties
| Compound Name | 4-(fluoroamino)-2,6-dimethylheptan-3-one |
| PubChem CID | 123501856 |
| Molecular Formula | C9H18FNO |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-(fluoroamino)-2,6-dimethylheptan-3-one |
| SMILES | CC(C)CC(NF)C(=O)C(C)C |
| InChI | InChI=1S/C9H18FNO/c1-6(2)5-8(11-10)9(12)7(3)4/h6-8,11H,5H2,1-4H3 |
| InChIKey | UOUSMLKLHWYHCH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(fluoroamino)-2,6-dimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(fluoroamino)-2,6-dimethylheptan-3-one?
The IUPAC name of 4-(fluoroamino)-2,6-dimethylheptan-3-one (CID 123501856) is 4-(fluoroamino)-2,6-dimethylheptan-3-one.
What is the SMILES notation for 4-(fluoroamino)-2,6-dimethylheptan-3-one?
The canonical SMILES for 4-(fluoroamino)-2,6-dimethylheptan-3-one is CC(C)CC(NF)C(=O)C(C)C.
What is the InChIKey of 4-(fluoroamino)-2,6-dimethylheptan-3-one?
The InChIKey is UOUSMLKLHWYHCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FNO/c1-6(2)5-8(11-10)9(12)7(3)4/h6-8,11H,5H2,1-4H3.
What are the key properties of 4-(fluoroamino)-2,6-dimethylheptan-3-one?
4-(fluoroamino)-2,6-dimethylheptan-3-one has a molecular weight of 175.25 g/mol, XLogP of 2.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(fluoroamino)-2,6-dimethylheptan-3-one is sourced from PubChem (CID 123501856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).