C26H31F4N5O4S — CID 123502052
2-fluoro-N-[3-methyl-1-[3-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-oxobutan-2-yl]-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxamide (PubChem CID 123502052) has the molecular formula C26H31F4N5O4S and a molecular weight of 585.62 g/mol. Its IUPAC name is 2-fluoro-N-[3-methyl-1-[3-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-oxobutan-2-yl]-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 2-fluoro-N-[3-methyl-1-[3-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-oxobutan-2-yl]-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 123502052 |
| Molecular Formula | C26H31F4N5O4S |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | 2-fluoro-N-[3-methyl-1-[3-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-oxobutan-2-yl]-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxamide |
| SMILES | Cc1csc(CN2C(=O)N(C)C(=O)C23CCN(C(=O)C(NC(=O)C2CC(C(F)(F)F)=CC=C2F)C(C)C)CC3)n1 |
| InChI | InChI=1S/C26H31F4N5O4S/c1-14(2)20(32-21(36)17-11-16(26(28,29)30)5-6-18(17)27)22(37)34-9-7-25(8-10-34)23(38)33(4)24(39)35(25)12-19-31-15(3)13-40-19/h5-6,13-14,17,20H,7-12H2,1-4H3,(H,32,36) |
| InChIKey | XNPAMVDJNGYMKU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|