C22H33F3N2O3S — CID 123502158
8-(2,2-dimethylpropylsulfonyl)-2-[4-(3,3,3-trifluoropropoxy)phenyl]-2,8-diazaspiro[4.5]decane (PubChem CID 123502158) has the molecular formula C22H33F3N2O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is 8-(2,2-dimethylpropylsulfonyl)-2-[4-(3,3,3-trifluoropropoxy)phenyl]-2,8-diazaspiro[4.5]decane.
| Compound Name | 8-(2,2-dimethylpropylsulfonyl)-2-[4-(3,3,3-trifluoropropoxy)phenyl]-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 123502158 |
| Molecular Formula | C22H33F3N2O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 8-(2,2-dimethylpropylsulfonyl)-2-[4-(3,3,3-trifluoropropoxy)phenyl]-2,8-diazaspiro[4.5]decane |
| SMILES | CC(C)(C)CS(=O)(=O)N1CCC2(CCN(c3ccc(OCCC(F)(F)F)cc3)C2)CC1 |
| InChI | InChI=1S/C22H33F3N2O3S/c1-20(2,3)17-31(28,29)27-13-9-21(10-14-27)8-12-26(16-21)18-4-6-19(7-5-18)30-15-11-22(23,24)25/h4-7H,8-17H2,1-3H3 |
| InChIKey | QPNKIBRRGVYMCL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|