C38H60NO3P — CID 123502188
phosphanyl 4-[3a-(2-hydroxyethylamino)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]cyclohex-3-ene-1-carboxylate (PubChem CID 123502188) has the molecular formula C38H60NO3P and a molecular weight of 609.88 g/mol. Its IUPAC name is phosphanyl 4-[3a-(2-hydroxyethylamino)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]cyclohex-3-ene-1-carboxylate.
| Compound Name | phosphanyl 4-[3a-(2-hydroxyethylamino)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 123502188 |
| Molecular Formula | C38H60NO3P |
| Molecular Weight | 609.88 g/mol |
| Exact Mass | 609.43 |
| IUPAC Name | phosphanyl 4-[3a-(2-hydroxyethylamino)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]cyclohex-3-ene-1-carboxylate |
| SMILES | C=C(C)C1CCC2(NCCO)CCC3(C)C(CCC4C5(C)CC=C(C6=CCC(C(=O)OP)CC6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C38H60NO3P/c1-24(2)27-14-19-38(39-22-23-40)21-20-36(6)29(32(27)38)12-13-31-35(5)17-15-28(25-8-10-26(11-9-25)33(41)42-43)34(3,4)30(35)16-18-37(31,36)7/h8,15,26-27,29-32,39-40H,1,9-14,16-23,43H2,2-7H3 |
| InChIKey | NAGXHJYQXXVNGJ-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.88 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|