About 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine
2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine (PubChem CID 123502416) has the molecular formula C8H16N4S
and a molecular weight of 200.31 g/mol. Its IUPAC name is 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine.
Molecular Properties
| Compound Name | 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine |
| PubChem CID | 123502416 |
| Molecular Formula | C8H16N4S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine |
| SMILES | CCc1cc(N(N)CCNC)sn1 |
| InChI | InChI=1S/C8H16N4S/c1-3-7-6-8(13-11-7)12(9)5-4-10-2/h6,10H,3-5,9H2,1-2H3 |
| InChIKey | BCUQUBQPLKJLBR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine?
The IUPAC name of 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine (CID 123502416) is 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine.
What is the SMILES notation for 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine?
The canonical SMILES for 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine is CCc1cc(N(N)CCNC)sn1.
What is the InChIKey of 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine?
The InChIKey is BCUQUBQPLKJLBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4S/c1-3-7-6-8(13-11-7)12(9)5-4-10-2/h6,10H,3-5,9H2,1-2H3.
What are the key properties of 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine?
2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine has a molecular weight of 200.31 g/mol, XLogP of 0.61, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino-(3-ethyl-1,2-thiazol-5-yl)amino]-N-methylethanamine is sourced from PubChem (CID 123502416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).