About 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine
1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine (PubChem CID 123502462) has the molecular formula C21H42N2
and a molecular weight of 322.58 g/mol. Its IUPAC name is 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine.
Molecular Properties
| Compound Name | 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine |
| PubChem CID | 123502462 |
| Molecular Formula | C21H42N2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.33 |
| IUPAC Name | 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine |
| SMILES | CC1(C)CCCCCCCCC(N2CCC(N)CC(C)(C)C2)C1 |
| InChI | InChI=1S/C21H42N2/c1-20(2)13-10-8-6-5-7-9-11-19(16-20)23-14-12-18(22)15-21(3,4)17-23/h18-19H,5-17,22H2,1-4H3 |
| InChIKey | ABWGIEDDMZRQFD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine?
The IUPAC name of 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine (CID 123502462) is 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine.
What is the SMILES notation for 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine?
The canonical SMILES for 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine is CC1(C)CCCCCCCCC(N2CCC(N)CC(C)(C)C2)C1.
What is the InChIKey of 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine?
The InChIKey is ABWGIEDDMZRQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42N2/c1-20(2)13-10-8-6-5-7-9-11-19(16-20)23-14-12-18(22)15-21(3,4)17-23/h18-19H,5-17,22H2,1-4H3.
What are the key properties of 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine?
1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine has a molecular weight of 322.58 g/mol, XLogP of 5.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylcycloundecyl)-6,6-dimethylazepan-4-amine is sourced from PubChem (CID 123502462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).