About 5-fluoro-6-methylhepta-4,6-dien-2-imine
5-fluoro-6-methylhepta-4,6-dien-2-imine (PubChem CID 123502589) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is 5-fluoro-6-methylhepta-4,6-dien-2-imine.
Molecular Properties
| Compound Name | 5-fluoro-6-methylhepta-4,6-dien-2-imine |
| PubChem CID | 123502589 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 5-fluoro-6-methylhepta-4,6-dien-2-imine |
| SMILES | [H]/N=C(\C)CC=C(F)C(=C)C |
| InChI | InChI=1S/C8H12FN/c1-6(2)8(9)5-4-7(3)10/h5,10H,1,4H2,2-3H3/b8-5?,10-7+ |
| InChIKey | UCJRNAPCRIKJNZ-NOFHWXGASA-N |
| XLogP | 2.85 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-6-methylhepta-4,6-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-methylhepta-4,6-dien-2-imine?
The IUPAC name of 5-fluoro-6-methylhepta-4,6-dien-2-imine (CID 123502589) is 5-fluoro-6-methylhepta-4,6-dien-2-imine.
What is the SMILES notation for 5-fluoro-6-methylhepta-4,6-dien-2-imine?
The canonical SMILES for 5-fluoro-6-methylhepta-4,6-dien-2-imine is [H]/N=C(\C)CC=C(F)C(=C)C.
What is the InChIKey of 5-fluoro-6-methylhepta-4,6-dien-2-imine?
The InChIKey is UCJRNAPCRIKJNZ-NOFHWXGASA-N. The full InChI is InChI=1S/C8H12FN/c1-6(2)8(9)5-4-7(3)10/h5,10H,1,4H2,2-3H3/b8-5?,10-7+.
What are the key properties of 5-fluoro-6-methylhepta-4,6-dien-2-imine?
5-fluoro-6-methylhepta-4,6-dien-2-imine has a molecular weight of 141.19 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methylhepta-4,6-dien-2-imine is sourced from PubChem (CID 123502589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).