C27H31N2O3+ — CID 123503585
[3-methyl-2-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-1,3-benzoxazol-3-ium-6-yl] formate (PubChem CID 123503585) has the molecular formula C27H31N2O3+ and a molecular weight of 431.56 g/mol. Its IUPAC name is [3-methyl-2-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-1,3-benzoxazol-3-ium-6-yl] formate.
| Compound Name | [3-methyl-2-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-1,3-benzoxazol-3-ium-6-yl] formate |
|---|---|
| PubChem CID | 123503585 |
| Molecular Formula | C27H31N2O3+ |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | [3-methyl-2-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-1,3-benzoxazol-3-ium-6-yl] formate |
| SMILES | C[n+]1c(C=Cc2cc3c4c(c2)C(C)(C)CCN4CCC3(C)C)oc2cc(OC=O)ccc21 |
| InChI | InChI=1S/C27H31N2O3/c1-26(2)10-12-29-13-11-27(3,4)21-15-18(14-20(26)25(21)29)6-9-24-28(5)22-8-7-19(31-17-30)16-23(22)32-24/h6-9,14-17H,10-13H2,1-5H3/q+1 |
| InChIKey | GGIPASPPBQAPCU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 46.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|