C26H21FN2O3S — CID 123503587
4-[3-[3-(4-fluorophenoxy)propoxy]phenyl]-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one (PubChem CID 123503587) has the molecular formula C26H21FN2O3S and a molecular weight of 460.53 g/mol. Its IUPAC name is 4-[3-[3-(4-fluorophenoxy)propoxy]phenyl]-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one.
| Compound Name | 4-[3-[3-(4-fluorophenoxy)propoxy]phenyl]-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 123503587 |
| Molecular Formula | C26H21FN2O3S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 4-[3-[3-(4-fluorophenoxy)propoxy]phenyl]-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one |
| SMILES | O=C1c2ccccc2C2=NC(=S)NC(c3cccc(OCCCOc4ccc(F)cc4)c3)C12 |
| InChI | InChI=1S/C26H21FN2O3S/c27-17-9-11-18(12-10-17)31-13-4-14-32-19-6-3-5-16(15-19)23-22-24(29-26(33)28-23)20-7-1-2-8-21(20)25(22)30/h1-3,5-12,15,22-23H,4,13-14H2,(H,28,33) |
| InChIKey | ROTPZUPROHSWHL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|