C24H28ClNO2S — CID 123503869
5-[2-[(3-chloro-2-pyridinyl)sulfanyl]ethyl]-2-(2,6-diethyl-4-methylphenyl)cyclohexane-1,3-dione (PubChem CID 123503869) has the molecular formula C24H28ClNO2S and a molecular weight of 430.01 g/mol. Its IUPAC name is 5-[2-[(3-chloro-2-pyridinyl)sulfanyl]ethyl]-2-(2,6-diethyl-4-methylphenyl)cyclohexane-1,3-dione.
| Compound Name | 5-[2-[(3-chloro-2-pyridinyl)sulfanyl]ethyl]-2-(2,6-diethyl-4-methylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 123503869 |
| Molecular Formula | C24H28ClNO2S |
| Molecular Weight | 430.01 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 5-[2-[(3-chloro-2-pyridinyl)sulfanyl]ethyl]-2-(2,6-diethyl-4-methylphenyl)cyclohexane-1,3-dione |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)CC(CCSc2ncccc2Cl)CC1=O |
| InChI | InChI=1S/C24H28ClNO2S/c1-4-17-11-15(3)12-18(5-2)22(17)23-20(27)13-16(14-21(23)28)8-10-29-24-19(25)7-6-9-26-24/h6-7,9,11-12,16,23H,4-5,8,10,13-14H2,1-3H3 |
| InChIKey | ZRRJYRLCGMGTSV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.01 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|