C13H17N3OS — CID 123504290
(cyclopropylamino)-(3,4,5-trimethylthieno[2,3-c]pyridazin-6-yl)methanol (PubChem CID 123504290) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is (cyclopropylamino)-(3,4,5-trimethylthieno[2,3-c]pyridazin-6-yl)methanol.
| Compound Name | (cyclopropylamino)-(3,4,5-trimethylthieno[2,3-c]pyridazin-6-yl)methanol |
|---|---|
| PubChem CID | 123504290 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (cyclopropylamino)-(3,4,5-trimethylthieno[2,3-c]pyridazin-6-yl)methanol |
| SMILES | Cc1nnc2sc(C(O)NC3CC3)c(C)c2c1C |
| InChI | InChI=1S/C13H17N3OS/c1-6-8(3)15-16-13-10(6)7(2)11(18-13)12(17)14-9-4-5-9/h9,12,14,17H,4-5H2,1-3H3 |
| InChIKey | LDQKANKZROMAKF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|