C22H28F4N4 — CID 123504334
N-ethyl-13-fluoro-4,10-dimethyl-N-pentyl-14-(trifluoromethyl)-2,3,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,7,11,13-hexaen-7-amine (PubChem CID 123504334) has the molecular formula C22H28F4N4 and a molecular weight of 424.49 g/mol. Its IUPAC name is N-ethyl-13-fluoro-4,10-dimethyl-N-pentyl-14-(trifluoromethyl)-2,3,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,7,11,13-hexaen-7-amine.
| Compound Name | N-ethyl-13-fluoro-4,10-dimethyl-N-pentyl-14-(trifluoromethyl)-2,3,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,7,11,13-hexaen-7-amine |
|---|---|
| PubChem CID | 123504334 |
| Molecular Formula | C22H28F4N4 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | N-ethyl-13-fluoro-4,10-dimethyl-N-pentyl-14-(trifluoromethyl)-2,3,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,7,11,13-hexaen-7-amine |
| SMILES | CCCCCN(CC)C1=CCC(C)c2cc(F)c(C(F)(F)F)cc2-n2nc(C)nc21 |
| InChI | InChI=1S/C22H28F4N4/c1-5-7-8-11-29(6-2)19-10-9-14(3)16-12-18(23)17(22(24,25)26)13-20(16)30-21(19)27-15(4)28-30/h10,12-14H,5-9,11H2,1-4H3 |
| InChIKey | GKGUJBJNNCHFLE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|