C25H35F3Si — CID 123504348
bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methyl-(6,6,6-trifluorohexyl)silane (PubChem CID 123504348) has the molecular formula C25H35F3Si and a molecular weight of 420.64 g/mol. Its IUPAC name is bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methyl-(6,6,6-trifluorohexyl)silane.
| Compound Name | bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methyl-(6,6,6-trifluorohexyl)silane |
|---|---|
| PubChem CID | 123504348 |
| Molecular Formula | C25H35F3Si |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methyl-(6,6,6-trifluorohexyl)silane |
| SMILES | C[Si](CCCCCC(F)(F)F)(C1CCC2C=CC=CC21)C1CCC2C=CC=CC21 |
| InChI | InChI=1S/C25H35F3Si/c1-29(18-8-2-7-17-25(26,27)28,23-15-13-19-9-3-5-11-21(19)23)24-16-14-20-10-4-6-12-22(20)24/h3-6,9-12,19-24H,2,7-8,13-18H2,1H3 |
| InChIKey | ORGPBEFZCDMNAK-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|