C18H17F4NO5S — CID 123504529
(10,12-dihydroxy-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-trien-11-yl) 1,1,2,2-tetrafluorobut-3-ene-1-sulfonate (PubChem CID 123504529) has the molecular formula C18H17F4NO5S and a molecular weight of 435.40 g/mol. Its IUPAC name is (10,12-dihydroxy-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-trien-11-yl) 1,1,2,2-tetrafluorobut-3-ene-1-sulfonate.
| Compound Name | (10,12-dihydroxy-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-trien-11-yl) 1,1,2,2-tetrafluorobut-3-ene-1-sulfonate |
|---|---|
| PubChem CID | 123504529 |
| Molecular Formula | C18H17F4NO5S |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (10,12-dihydroxy-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-trien-11-yl) 1,1,2,2-tetrafluorobut-3-ene-1-sulfonate |
| SMILES | C=CC(F)(F)C(F)(F)S(=O)(=O)On1c(O)c2c(c1O)C1CC2C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C18H17F4NO5S/c1-2-17(19,20)18(21,22)29(26,27)28-23-15(24)13-9-6-10(14(13)16(23)25)12-8-4-3-7(5-8)11(9)12/h2-4,7-12,24-25H,1,5-6H2 |
| InChIKey | REGRVVZYFDZBBW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|