C12H16N2O — CID 123504577
2-methyl-5-(5-methylocta-1,3,5-trien-2-yl)-1,3,4-oxadiazole (PubChem CID 123504577) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-methyl-5-(5-methylocta-1,3,5-trien-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-methyl-5-(5-methylocta-1,3,5-trien-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 123504577 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-methyl-5-(5-methylocta-1,3,5-trien-2-yl)-1,3,4-oxadiazole |
| SMILES | C=C(C=CC(C)=CCC)c1nnc(C)o1 |
| InChI | InChI=1S/C12H16N2O/c1-5-6-9(2)7-8-10(3)12-14-13-11(4)15-12/h6-8H,3,5H2,1-2,4H3 |
| InChIKey | YSEFQPLOXZRSFS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|