C36H10F10N4 — CID 123504786
3-[(Z)-[(4Z)-4-[cyano-(3-isocyanophenyl)methylidene]-2,5-bis(2,3,4,5,6-pentafluorophenyl)cyclohexa-2,5-dien-1-ylidene]-isocyanomethyl]benzonitrile (PubChem CID 123504786) has the molecular formula C36H10F10N4 and a molecular weight of 688.48 g/mol. Its IUPAC name is 3-[(Z)-[(4Z)-4-[cyano-(3-isocyanophenyl)methylidene]-2,5-bis(2,3,4,5,6-pentafluorophenyl)cyclohexa-2,5-dien-1-ylidene]-isocyanomethyl]benzonitrile.
| Compound Name | 3-[(Z)-[(4Z)-4-[cyano-(3-isocyanophenyl)methylidene]-2,5-bis(2,3,4,5,6-pentafluorophenyl)cyclohexa-2,5-dien-1-ylidene]-isocyanomethyl]benzonitrile |
|---|---|
| PubChem CID | 123504786 |
| Molecular Formula | C36H10F10N4 |
| Molecular Weight | 688.48 g/mol |
| Exact Mass | 688.07 |
| IUPAC Name | 3-[(Z)-[(4Z)-4-[cyano-(3-isocyanophenyl)methylidene]-2,5-bis(2,3,4,5,6-pentafluorophenyl)cyclohexa-2,5-dien-1-ylidene]-isocyanomethyl]benzonitrile |
| SMILES | [C-]#[N+]/C(c1cccc(C#N)c1)=c1/cc(-c2c(F)c(F)c(F)c(F)c2F)/c(=C(\C#N)c2cccc([N+]#[C-])c2)cc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C36H10F10N4/c1-49-18-8-4-6-16(10-18)23(14-48)19-11-21(25-28(39)32(43)35(46)33(44)29(25)40)22(36(50-2)17-7-3-5-15(9-17)13-47)12-20(19)24-26(37)30(41)34(45)31(42)27(24)38/h3-12H/b23-19+,36-22- |
| InChIKey | SCIMMWKZUZBHTA-GQVUPETGSA-N |
| XLogP | 8.63 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.48 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|