C29H29FN4O3 — CID 123504802
N-[1-(4-fluorophenyl)ethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-5-carboxamide (PubChem CID 123504802) has the molecular formula C29H29FN4O3 and a molecular weight of 500.57 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-5-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 123504802 |
| Molecular Formula | C29H29FN4O3 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-5-carboxamide |
| SMILES | CC(NC(=O)c1ccc2c(c1)C(/C=N/c1cccc(CN3CCOCC3)c1)C(=O)N2)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H29FN4O3/c1-19(21-5-8-23(30)9-6-21)32-28(35)22-7-10-27-25(16-22)26(29(36)33-27)17-31-24-4-2-3-20(15-24)18-34-11-13-37-14-12-34/h2-10,15-17,19,26H,11-14,18H2,1H3,(H,32,35)(H,33,36)/b31-17+ |
| InChIKey | MQZNBTIGTORYCE-KBVAKVRCSA-N |
| XLogP | 4.59 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|