C22H43N — CID 123504857
2,3,5,8,9,10-hexamethyl-N-propan-2-yltridec-4-en-1-imine (PubChem CID 123504857) has the molecular formula C22H43N and a molecular weight of 321.59 g/mol. Its IUPAC name is 2,3,5,8,9,10-hexamethyl-N-propan-2-yltridec-4-en-1-imine.
| Compound Name | 2,3,5,8,9,10-hexamethyl-N-propan-2-yltridec-4-en-1-imine |
|---|---|
| PubChem CID | 123504857 |
| Molecular Formula | C22H43N |
| Molecular Weight | 321.59 g/mol |
| Exact Mass | 321.34 |
| IUPAC Name | 2,3,5,8,9,10-hexamethyl-N-propan-2-yltridec-4-en-1-imine |
| SMILES | CCCC(C)C(C)C(C)CCC(C)=CC(C)C(C)/C=N/C(C)C |
| InChI | InChI=1S/C22H43N/c1-10-11-18(5)22(9)19(6)13-12-17(4)14-20(7)21(8)15-23-16(2)3/h14-16,18-22H,10-13H2,1-9H3/b17-14?,23-15+ |
| InChIKey | XVJKWJYYXKAWPK-MLZLBPKSSA-N |
| XLogP | 7.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.59 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|