C29H32N2O4 — CID 1235049
ethyl 1-benzyl-5-[(2S)-3-(benzylamino)-2-hydroxypropoxy]-2-methylindole-3-carboxylate (PubChem CID 1235049) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is ethyl 1-benzyl-5-[(2S)-3-(benzylamino)-2-hydroxypropoxy]-2-methylindole-3-carboxylate.
| Compound Name | ethyl 1-benzyl-5-[(2S)-3-(benzylamino)-2-hydroxypropoxy]-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 1235049 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | ethyl 1-benzyl-5-[(2S)-3-(benzylamino)-2-hydroxypropoxy]-2-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(Cc2ccccc2)c2ccc(OC[C@@H](O)CNCc3ccccc3)cc12 |
| InChI | InChI=1S/C29H32N2O4/c1-3-34-29(33)28-21(2)31(19-23-12-8-5-9-13-23)27-15-14-25(16-26(27)28)35-20-24(32)18-30-17-22-10-6-4-7-11-22/h4-16,24,30,32H,3,17-20H2,1-2H3/t24-/m0/s1 |
| InChIKey | JYDFCPKCKYZYRH-DEOSSOPVSA-N |
| XLogP | 4.70 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |