C24H26N2O3 — CID 123505115
(1S,2R,6S,7R,8S)-8-(3,6-dimethylpyrazin-2-yl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123505115) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S)-8-(3,6-dimethylpyrazin-2-yl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S)-8-(3,6-dimethylpyrazin-2-yl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123505115 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (1S,2R,6S,7R,8S)-8-(3,6-dimethylpyrazin-2-yl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1cc(C)c(C2C(=O)[C@@H]3[C@@H]4O[C@@H](C[C@H]4c4nc(C)cnc4C)[C@@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C24H26N2O3/c1-10-6-11(2)17(12(3)7-10)19-22(27)18-16-8-15(24(29-16)20(18)23(19)28)21-14(5)25-9-13(4)26-21/h6-7,9,15-16,18-20,24H,8H2,1-5H3/t15-,16-,18-,19?,20+,24+/m0/s1 |
| InChIKey | BOHLVUDSQHESBS-WRDMFGEQSA-N |
| XLogP | 3.44 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|