C26H42N2O3S — CID 123505356
N-[3-[2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethylamino]butan-2-yl]-2,6-di(propan-2-yl)benzenesulfonamide (PubChem CID 123505356) has the molecular formula C26H42N2O3S and a molecular weight of 462.70 g/mol. Its IUPAC name is N-[3-[2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethylamino]butan-2-yl]-2,6-di(propan-2-yl)benzenesulfonamide.
| Compound Name | N-[3-[2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethylamino]butan-2-yl]-2,6-di(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 123505356 |
| Molecular Formula | C26H42N2O3S |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | N-[3-[2-[(4-methylcyclohexa-1,4-dien-1-yl)methoxy]ethylamino]butan-2-yl]-2,6-di(propan-2-yl)benzenesulfonamide |
| SMILES | CC1=CCC(COCCNC(C)C(C)NS(=O)(=O)c2c(C(C)C)cccc2C(C)C)=CC1 |
| InChI | InChI=1S/C26H42N2O3S/c1-18(2)24-9-8-10-25(19(3)4)26(24)32(29,30)28-22(7)21(6)27-15-16-31-17-23-13-11-20(5)12-14-23/h8-11,14,18-19,21-22,27-28H,12-13,15-17H2,1-7H3 |
| InChIKey | YFMYVTFQBVRPEM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|