C15H20 — CID 123505407
2-but-1-enyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene (PubChem CID 123505407) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 2-but-1-enyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene.
| Compound Name | 2-but-1-enyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene |
|---|---|
| PubChem CID | 123505407 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-but-1-enyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene |
| SMILES | CCC=CC1CCC2=C(CC=CC=C2)C1 |
| InChI | InChI=1S/C15H20/c1-2-3-7-13-10-11-14-8-5-4-6-9-15(14)12-13/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | FXSXBEIFNWEXIZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|