About 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole
5-ethyl-1,3-bis(oxolan-3-yl)pyrazole (PubChem CID 123506168) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole.
Molecular Properties
| Compound Name | 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole |
| PubChem CID | 123506168 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole |
| SMILES | CCc1cc(C2CCOC2)nn1C1CCOC1 |
| InChI | InChI=1S/C13H20N2O2/c1-2-11-7-13(10-3-5-16-8-10)14-15(11)12-4-6-17-9-12/h7,10,12H,2-6,8-9H2,1H3 |
| InChIKey | CEPWMRXTUCHYEU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole?
The IUPAC name of 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole (CID 123506168) is 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole.
What is the SMILES notation for 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole?
The canonical SMILES for 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole is CCc1cc(C2CCOC2)nn1C1CCOC1.
What is the InChIKey of 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole?
The InChIKey is CEPWMRXTUCHYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-2-11-7-13(10-3-5-16-8-10)14-15(11)12-4-6-17-9-12/h7,10,12H,2-6,8-9H2,1H3.
What are the key properties of 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole?
5-ethyl-1,3-bis(oxolan-3-yl)pyrazole has a molecular weight of 236.31 g/mol, XLogP of 1.91, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3-bis(oxolan-3-yl)pyrazole is sourced from PubChem (CID 123506168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).