About 5-fluoro-2-methyl-5,6-dihydro-1H-indole
5-fluoro-2-methyl-5,6-dihydro-1H-indole (PubChem CID 123506170) has the molecular formula C9H10FN
and a molecular weight of 151.18 g/mol. Its IUPAC name is 5-fluoro-2-methyl-5,6-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-fluoro-2-methyl-5,6-dihydro-1H-indole |
| PubChem CID | 123506170 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 5-fluoro-2-methyl-5,6-dihydro-1H-indole |
| SMILES | Cc1cc2c([nH]1)=CCC(F)C=2 |
| InChI | InChI=1S/C9H10FN/c1-6-4-7-5-8(10)2-3-9(7)11-6/h3-5,8,11H,2H2,1H3 |
| InChIKey | VWHYIQHVIDNQQA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-fluoro-2-methyl-5,6-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methyl-5,6-dihydro-1H-indole?
The IUPAC name of 5-fluoro-2-methyl-5,6-dihydro-1H-indole (CID 123506170) is 5-fluoro-2-methyl-5,6-dihydro-1H-indole.
What is the SMILES notation for 5-fluoro-2-methyl-5,6-dihydro-1H-indole?
The canonical SMILES for 5-fluoro-2-methyl-5,6-dihydro-1H-indole is Cc1cc2c([nH]1)=CCC(F)C=2.
What is the InChIKey of 5-fluoro-2-methyl-5,6-dihydro-1H-indole?
The InChIKey is VWHYIQHVIDNQQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN/c1-6-4-7-5-8(10)2-3-9(7)11-6/h3-5,8,11H,2H2,1H3.
What are the key properties of 5-fluoro-2-methyl-5,6-dihydro-1H-indole?
5-fluoro-2-methyl-5,6-dihydro-1H-indole has a molecular weight of 151.18 g/mol, XLogP of 0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methyl-5,6-dihydro-1H-indole is sourced from PubChem (CID 123506170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).