C12H12F3N3OS — CID 123506430
(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)-(2,2,2-trifluoroethylamino)methanol (PubChem CID 123506430) has the molecular formula C12H12F3N3OS and a molecular weight of 303.31 g/mol. Its IUPAC name is (4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)-(2,2,2-trifluoroethylamino)methanol.
| Compound Name | (4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)-(2,2,2-trifluoroethylamino)methanol |
|---|---|
| PubChem CID | 123506430 |
| Molecular Formula | C12H12F3N3OS |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)-(2,2,2-trifluoroethylamino)methanol |
| SMILES | Cc1nc(C(O)NCC(F)(F)F)sc1-c1cccnc1 |
| InChI | InChI=1S/C12H12F3N3OS/c1-7-9(8-3-2-4-16-5-8)20-11(18-7)10(19)17-6-12(13,14)15/h2-5,10,17,19H,6H2,1H3 |
| InChIKey | LCCXHIGWELWWFR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|