C35H22N4O — CID 123506912
9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]furo[2,3-b]carbazole (PubChem CID 123506912) has the molecular formula C35H22N4O and a molecular weight of 514.59 g/mol. Its IUPAC name is 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]furo[2,3-b]carbazole.
| Compound Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]furo[2,3-b]carbazole |
|---|---|
| PubChem CID | 123506912 |
| Molecular Formula | C35H22N4O |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]furo[2,3-b]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-n4c5ccccc5c5cc6ccoc6cc54)cc3)n2)cc1 |
| InChI | InChI=1S/C35H22N4O/c1-3-9-23(10-4-1)33-36-34(24-11-5-2-6-12-24)38-35(37-33)25-15-17-27(18-16-25)39-30-14-8-7-13-28(30)29-21-26-19-20-40-32(26)22-31(29)39/h1-22H |
| InChIKey | YMWNIPHASMIXER-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |