C26H22Cl2F4N4O3 — CID 123507222
4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-N-[2-[2-(methylamino)ethoxyamino]ethenyl]naphthalene-1-carboxamide (PubChem CID 123507222) has the molecular formula C26H22Cl2F4N4O3 and a molecular weight of 585.39 g/mol. Its IUPAC name is 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-N-[2-[2-(methylamino)ethoxyamino]ethenyl]naphthalene-1-carboxamide.
| Compound Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-N-[2-[2-(methylamino)ethoxyamino]ethenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 123507222 |
| Molecular Formula | C26H22Cl2F4N4O3 |
| Molecular Weight | 585.39 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-N-[2-[2-(methylamino)ethoxyamino]ethenyl]naphthalene-1-carboxamide |
| SMILES | CNCCONC=CNC(=O)c1ccc(C2=CC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)ON2)c2ccccc12 |
| InChI | InChI=1S/C26H22Cl2F4N4O3/c1-33-10-11-38-35-9-8-34-24(37)19-7-6-18(16-4-2-3-5-17(16)19)22-14-25(39-36-22,26(30,31)32)15-12-20(27)23(29)21(28)13-15/h2-9,12-14,33,35-36H,10-11H2,1H3,(H,34,37) |
| InChIKey | CARWKMKWHAHEHF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|