C40H54O9Si2 — CID 123507229
bis(3,5-diethoxyphenyl)silyloxy-bis(3,5-diethoxyphenyl)silane (PubChem CID 123507229) has the molecular formula C40H54O9Si2 and a molecular weight of 735.03 g/mol. Its IUPAC name is bis(3,5-diethoxyphenyl)silyloxy-bis(3,5-diethoxyphenyl)silane.
| Compound Name | bis(3,5-diethoxyphenyl)silyloxy-bis(3,5-diethoxyphenyl)silane |
|---|---|
| PubChem CID | 123507229 |
| Molecular Formula | C40H54O9Si2 |
| Molecular Weight | 735.03 g/mol |
| Exact Mass | 734.33 |
| IUPAC Name | bis(3,5-diethoxyphenyl)silyloxy-bis(3,5-diethoxyphenyl)silane |
| SMILES | CCOc1cc(OCC)cc([SiH](O[SiH](c2cc(OCC)cc(OCC)c2)c2cc(OCC)cc(OCC)c2)c2cc(OCC)cc(OCC)c2)c1 |
| InChI | InChI=1S/C40H54O9Si2/c1-9-41-29-17-30(42-10-2)22-37(21-29)50(38-23-31(43-11-3)18-32(24-38)44-12-4)49-51(39-25-33(45-13-5)19-34(26-39)46-14-6)40-27-35(47-15-7)20-36(28-40)48-16-8/h17-28,50-51H,9-16H2,1-8H3 |
| InChIKey | VBCRPVGRDDPSPG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.03 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|