C15H18FNO2 — CID 123507515
(2E)-2-fluoro-4-[[(2Z,4Z)-2,3,5-trimethylhepta-2,4,6-trienylidene]amino]penta-2,4-dienoic acid (PubChem CID 123507515) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is (2E)-2-fluoro-4-[[(2Z,4Z)-2,3,5-trimethylhepta-2,4,6-trienylidene]amino]penta-2,4-dienoic acid.
| Compound Name | (2E)-2-fluoro-4-[[(2Z,4Z)-2,3,5-trimethylhepta-2,4,6-trienylidene]amino]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 123507515 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (2E)-2-fluoro-4-[[(2Z,4Z)-2,3,5-trimethylhepta-2,4,6-trienylidene]amino]penta-2,4-dienoic acid |
| SMILES | C=C/C(C)=C\C(C)=C(C)/C=N/C(=C)/C=C(/F)C(=O)O |
| InChI | InChI=1S/C15H18FNO2/c1-6-10(2)7-11(3)12(4)9-17-13(5)8-14(16)15(18)19/h6-9H,1,5H2,2-4H3,(H,18,19)/b10-7-,12-11-,14-8+,17-9+ |
| InChIKey | AGEAXUXTIYMUIG-KEINEOENSA-N |
| XLogP | 3.98 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|