C50H32N8 — CID 123507806
3,11-bis[4-(1-phenylbenzimidazol-2-yl)phenyl]-2,8,10,16-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,10,13,15-octaene (PubChem CID 123507806) has the molecular formula C50H32N8 and a molecular weight of 744.86 g/mol. Its IUPAC name is 3,11-bis[4-(1-phenylbenzimidazol-2-yl)phenyl]-2,8,10,16-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,10,13,15-octaene.
| Compound Name | 3,11-bis[4-(1-phenylbenzimidazol-2-yl)phenyl]-2,8,10,16-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,10,13,15-octaene |
|---|---|
| PubChem CID | 123507806 |
| Molecular Formula | C50H32N8 |
| Molecular Weight | 744.86 g/mol |
| Exact Mass | 744.27 |
| IUPAC Name | 3,11-bis[4-(1-phenylbenzimidazol-2-yl)phenyl]-2,8,10,16-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,10,13,15-octaene |
| SMILES | c1ccc(-n2c(-c3ccc(C4=Nc5ncccc5C(c5ccc(-c6nc7ccccc7n6-c6ccccc6)cc5)=Nc5ncccc54)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C50H32N8/c1-3-13-37(14-4-1)57-43-21-9-7-19-41(43)53-49(57)35-27-23-33(24-28-35)45-39-17-11-31-51-47(39)56-46(40-18-12-32-52-48(40)55-45)34-25-29-36(30-26-34)50-54-42-20-8-10-22-44(42)58(50)38-15-5-2-6-16-38/h1-32H |
| InChIKey | GHQKQBGJOUHGJH-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.86 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |